C17H14ClFINO2S — CID 121391201
N-(3-chloro-4-fluorophenyl)-4-iodo-3-(oxolan-3-ylsulfanyl)benzamide (PubChem CID 121391201) has the molecular formula C17H14ClFINO2S and a molecular weight of 477.73 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-iodo-3-(oxolan-3-ylsulfanyl)benzamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-iodo-3-(oxolan-3-ylsulfanyl)benzamide |
|---|---|
| PubChem CID | 121391201 |
| Molecular Formula | C17H14ClFINO2S |
| Molecular Weight | 477.73 g/mol |
| Exact Mass | 476.95 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-iodo-3-(oxolan-3-ylsulfanyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1ccc(I)c(SC2CCOC2)c1 |
| InChI | InChI=1S/C17H14ClFINO2S/c18-13-8-11(2-3-14(13)19)21-17(22)10-1-4-15(20)16(7-10)24-12-5-6-23-9-12/h1-4,7-8,12H,5-6,9H2,(H,21,22) |
| InChIKey | CUEWUUBVPBZKCN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.73 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|