C22H21F3INO3S — CID 121391196
1-ethyl-4-[2-iodo-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfanylcyclohexane-1-carboxylic acid (PubChem CID 121391196) has the molecular formula C22H21F3INO3S and a molecular weight of 563.38 g/mol. Its IUPAC name is 1-ethyl-4-[2-iodo-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfanylcyclohexane-1-carboxylic acid.
| Compound Name | 1-ethyl-4-[2-iodo-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfanylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 121391196 |
| Molecular Formula | C22H21F3INO3S |
| Molecular Weight | 563.38 g/mol |
| Exact Mass | 563.02 |
| IUPAC Name | 1-ethyl-4-[2-iodo-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfanylcyclohexane-1-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCC(Sc2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2I)CC1 |
| InChI | InChI=1S/C22H21F3INO3S/c1-2-22(21(29)30)7-5-14(6-8-22)31-18-9-12(3-4-17(18)26)20(28)27-13-10-15(23)19(25)16(24)11-13/h3-4,9-11,14H,2,5-8H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | GDIYJCMYWPWKIH-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.38 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|