C19H17F4NOS — CID 145095059
3-[(1-ethylcyclopropyl)methylsulfanyl]-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 145095059) has the molecular formula C19H17F4NOS and a molecular weight of 383.41 g/mol. Its IUPAC name is 3-[(1-ethylcyclopropyl)methylsulfanyl]-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 3-[(1-ethylcyclopropyl)methylsulfanyl]-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 145095059 |
| Molecular Formula | C19H17F4NOS |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 3-[(1-ethylcyclopropyl)methylsulfanyl]-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CCC1(CSc2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2F)CC1 |
| InChI | InChI=1S/C19H17F4NOS/c1-2-19(5-6-19)10-26-16-7-11(3-4-13(16)20)18(25)24-12-8-14(21)17(23)15(22)9-12/h3-4,7-9H,2,5-6,10H2,1H3,(H,24,25) |
| InChIKey | QBFXIBOWWZGGSQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|