C17H15F4NOS — CID 121364031
3-tert-butylsulfanyl-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 121364031) has the molecular formula C17H15F4NOS and a molecular weight of 357.37 g/mol. Its IUPAC name is 3-tert-butylsulfanyl-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 3-tert-butylsulfanyl-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 121364031 |
| Molecular Formula | C17H15F4NOS |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 3-tert-butylsulfanyl-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC(C)(C)Sc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1F |
| InChI | InChI=1S/C17H15F4NOS/c1-17(2,3)24-14-6-9(4-5-11(14)18)16(23)22-10-7-12(19)15(21)13(20)8-10/h4-8H,1-3H3,(H,22,23) |
| InChIKey | OSVDLOKPZMMOTN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|