C21H22ClFINOS — CID 121391203
N-(3-chloro-4-fluorophenyl)-3-(3,3-dimethylcyclohexyl)sulfanyl-4-iodobenzamide (PubChem CID 121391203) has the molecular formula C21H22ClFINOS and a molecular weight of 517.84 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-(3,3-dimethylcyclohexyl)sulfanyl-4-iodobenzamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-(3,3-dimethylcyclohexyl)sulfanyl-4-iodobenzamide |
|---|---|
| PubChem CID | 121391203 |
| Molecular Formula | C21H22ClFINOS |
| Molecular Weight | 517.84 g/mol |
| Exact Mass | 517.01 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-(3,3-dimethylcyclohexyl)sulfanyl-4-iodobenzamide |
| SMILES | CC1(C)CCCC(Sc2cc(C(=O)Nc3ccc(F)c(Cl)c3)ccc2I)C1 |
| InChI | InChI=1S/C21H22ClFINOS/c1-21(2)9-3-4-15(12-21)27-19-10-13(5-8-18(19)24)20(26)25-14-6-7-17(23)16(22)11-14/h5-8,10-11,15H,3-4,9,12H2,1-2H3,(H,25,26) |
| InChIKey | OJDWHIBHNNYROB-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.84 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|