C23H19ClF2N2O7S — CID 163958904
(2S)-2-[[2-[3-[2-chloro-5-[(3,4-difluorophenyl)carbamoyl]phenyl]sulfonyl-1-hydroxycyclobutyl]acetyl]amino]but-3-ynoic acid (PubChem CID 163958904) has the molecular formula C23H19ClF2N2O7S and a molecular weight of 540.93 g/mol. Its IUPAC name is (2S)-2-[[2-[3-[2-chloro-5-[(3,4-difluorophenyl)carbamoyl]phenyl]sulfonyl-1-hydroxycyclobutyl]acetyl]amino]but-3-ynoic acid.
| Compound Name | (2S)-2-[[2-[3-[2-chloro-5-[(3,4-difluorophenyl)carbamoyl]phenyl]sulfonyl-1-hydroxycyclobutyl]acetyl]amino]but-3-ynoic acid |
|---|---|
| PubChem CID | 163958904 |
| Molecular Formula | C23H19ClF2N2O7S |
| Molecular Weight | 540.93 g/mol |
| Exact Mass | 540.06 |
| IUPAC Name | (2S)-2-[[2-[3-[2-chloro-5-[(3,4-difluorophenyl)carbamoyl]phenyl]sulfonyl-1-hydroxycyclobutyl]acetyl]amino]but-3-ynoic acid |
| SMILES | C#C[C@H](NC(=O)CC1(O)CC(S(=O)(=O)c2cc(C(=O)Nc3ccc(F)c(F)c3)ccc2Cl)C1)C(=O)O |
| InChI | InChI=1S/C23H19ClF2N2O7S/c1-2-18(22(31)32)28-20(29)11-23(33)9-14(10-23)36(34,35)19-7-12(3-5-15(19)24)21(30)27-13-4-6-16(25)17(26)8-13/h1,3-8,14,18,33H,9-11H2,(H,27,30)(H,28,29)(H,31,32)/t14?,18-,23?/m0/s1 |
| InChIKey | SFTXCIDADGVHDU-SCTWRPTPSA-N |
| XLogP | 2.13 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.93 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|