C24H24ClF3N2O3S — CID 130402439
methyl N-[(5R,6S)-3-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfanyl-6-methyl-8-bicyclo[3.2.1]octanyl]carbamate (PubChem CID 130402439) has the molecular formula C24H24ClF3N2O3S and a molecular weight of 512.98 g/mol. Its IUPAC name is methyl N-[(5R,6S)-3-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfanyl-6-methyl-8-bicyclo[3.2.1]octanyl]carbamate.
| Compound Name | methyl N-[(5R,6S)-3-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfanyl-6-methyl-8-bicyclo[3.2.1]octanyl]carbamate |
|---|---|
| PubChem CID | 130402439 |
| Molecular Formula | C24H24ClF3N2O3S |
| Molecular Weight | 512.98 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | methyl N-[(5R,6S)-3-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfanyl-6-methyl-8-bicyclo[3.2.1]octanyl]carbamate |
| SMILES | COC(=O)NC1C2CC(Sc3cc(C(=O)Nc4cc(F)c(F)c(F)c4)ccc3Cl)C[C@@H]1[C@@H](C)C2 |
| InChI | InChI=1S/C24H24ClF3N2O3S/c1-11-5-13-6-15(10-16(11)22(13)30-24(32)33-2)34-20-7-12(3-4-17(20)25)23(31)29-14-8-18(26)21(28)19(27)9-14/h3-4,7-9,11,13,15-16,22H,5-6,10H2,1-2H3,(H,29,31)(H,30,32)/t11-,13?,15?,16+,22?/m0/s1 |
| InChIKey | GNADAKRCHHYGEG-LCKFKFDASA-N |
| XLogP | 6.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.98 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|