C27H28ClF3N2O3S — CID 130402301
3-[(5'S)-3-acetyl-2,2-dimethylspiro[1,3-oxazolidine-5,8'-bicyclo[3.2.1]octane]-3'-yl]sulfanyl-4-chloro-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130402301) has the molecular formula C27H28ClF3N2O3S and a molecular weight of 553.05 g/mol. Its IUPAC name is 3-[(5'S)-3-acetyl-2,2-dimethylspiro[1,3-oxazolidine-5,8'-bicyclo[3.2.1]octane]-3'-yl]sulfanyl-4-chloro-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 3-[(5'S)-3-acetyl-2,2-dimethylspiro[1,3-oxazolidine-5,8'-bicyclo[3.2.1]octane]-3'-yl]sulfanyl-4-chloro-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130402301 |
| Molecular Formula | C27H28ClF3N2O3S |
| Molecular Weight | 553.05 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 3-[(5'S)-3-acetyl-2,2-dimethylspiro[1,3-oxazolidine-5,8'-bicyclo[3.2.1]octane]-3'-yl]sulfanyl-4-chloro-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC(=O)N1CC2(OC1(C)C)C1CC[C@H]2CC(Sc2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2Cl)C1 |
| InChI | InChI=1S/C27H28ClF3N2O3S/c1-14(34)33-13-27(36-26(33,2)3)16-5-6-17(27)10-19(9-16)37-23-8-15(4-7-20(23)28)25(35)32-18-11-21(29)24(31)22(30)12-18/h4,7-8,11-12,16-17,19H,5-6,9-10,13H2,1-3H3,(H,32,35)/t16-,17?,19?,27?/m0/s1 |
| InChIKey | KCXLNDWRRYANKU-BUVJPRTLSA-N |
| XLogP | 6.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.05 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|