C23H24ClF3N2O4S2 — CID 130402310
4-chloro-3-[(1R,4S)-4-hydroxy-4-(methanesulfonamidomethyl)-3-methyl-5-methylidenecyclohexyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130402310) has the molecular formula C23H24ClF3N2O4S2 and a molecular weight of 549.04 g/mol. Its IUPAC name is 4-chloro-3-[(1R,4S)-4-hydroxy-4-(methanesulfonamidomethyl)-3-methyl-5-methylidenecyclohexyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[(1R,4S)-4-hydroxy-4-(methanesulfonamidomethyl)-3-methyl-5-methylidenecyclohexyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130402310 |
| Molecular Formula | C23H24ClF3N2O4S2 |
| Molecular Weight | 549.04 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | 4-chloro-3-[(1R,4S)-4-hydroxy-4-(methanesulfonamidomethyl)-3-methyl-5-methylidenecyclohexyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | C=C1C[C@H](Sc2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2Cl)CC(C)[C@@]1(O)CNS(C)(=O)=O |
| InChI | InChI=1S/C23H24ClF3N2O4S2/c1-12-6-16(7-13(2)23(12,31)11-28-35(3,32)33)34-20-8-14(4-5-17(20)24)22(30)29-15-9-18(25)21(27)19(26)10-15/h4-5,8-10,13,16,28,31H,1,6-7,11H2,2-3H3,(H,29,30)/t13?,16-,23+/m0/s1 |
| InChIKey | PHDUNQXBYRRTEL-VQGGCRBQSA-N |
| XLogP | 4.74 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.04 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|