C18H17F3N2O2S — CID 121370730
2-(4-hydroxycyclohexyl)sulfanyl-N-(3,4,5-trifluorophenyl)pyridine-4-carboxamide (PubChem CID 121370730) has the molecular formula C18H17F3N2O2S and a molecular weight of 382.41 g/mol. Its IUPAC name is 2-(4-hydroxycyclohexyl)sulfanyl-N-(3,4,5-trifluorophenyl)pyridine-4-carboxamide.
| Compound Name | 2-(4-hydroxycyclohexyl)sulfanyl-N-(3,4,5-trifluorophenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 121370730 |
| Molecular Formula | C18H17F3N2O2S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2-(4-hydroxycyclohexyl)sulfanyl-N-(3,4,5-trifluorophenyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccnc(SC2CCC(O)CC2)c1 |
| InChI | InChI=1S/C18H17F3N2O2S/c19-14-8-11(9-15(20)17(14)21)23-18(25)10-5-6-22-16(7-10)26-13-3-1-12(24)2-4-13/h5-9,12-13,24H,1-4H2,(H,23,25) |
| InChIKey | TXRXHRWNCRYJDI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|