C20H20F3N3O2S — CID 146304050
2-(4-hydroxycyclohexyl)-N-(3,4,5-trifluorophenyl)-3,4-dihydro-1,2,4-benzothiadiazine-7-carboxamide (PubChem CID 146304050) has the molecular formula C20H20F3N3O2S and a molecular weight of 423.46 g/mol. Its IUPAC name is 2-(4-hydroxycyclohexyl)-N-(3,4,5-trifluorophenyl)-3,4-dihydro-1,2,4-benzothiadiazine-7-carboxamide.
| Compound Name | 2-(4-hydroxycyclohexyl)-N-(3,4,5-trifluorophenyl)-3,4-dihydro-1,2,4-benzothiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 146304050 |
| Molecular Formula | C20H20F3N3O2S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-(4-hydroxycyclohexyl)-N-(3,4,5-trifluorophenyl)-3,4-dihydro-1,2,4-benzothiadiazine-7-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc2c(c1)SN(C1CCC(O)CC1)CN2 |
| InChI | InChI=1S/C20H20F3N3O2S/c21-15-8-12(9-16(22)19(15)23)25-20(28)11-1-6-17-18(7-11)29-26(10-24-17)13-2-4-14(27)5-3-13/h1,6-9,13-14,24,27H,2-5,10H2,(H,25,28) |
| InChIKey | LYEWPLICJZAPGQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|