C21H20F6N2O4 — CID 144890710
3-(4,4-difluoro-5-hydroxyazepan-1-yl)-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide;formaldehyde (PubChem CID 144890710) has the molecular formula C21H20F6N2O4 and a molecular weight of 478.39 g/mol. Its IUPAC name is 3-(4,4-difluoro-5-hydroxyazepan-1-yl)-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide;formaldehyde.
| Compound Name | 3-(4,4-difluoro-5-hydroxyazepan-1-yl)-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide;formaldehyde |
|---|---|
| PubChem CID | 144890710 |
| Molecular Formula | C21H20F6N2O4 |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 3-(4,4-difluoro-5-hydroxyazepan-1-yl)-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide;formaldehyde |
| SMILES | C=O.C=O.O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(F)c(N2CCC(O)C(F)(F)CC2)c1 |
| InChI | InChI=1S/C19H16F6N2O2.2CH2O/c20-12-2-1-10(18(29)26-11-8-13(21)17(23)14(22)9-11)7-15(12)27-5-3-16(28)19(24,25)4-6-27;2*1-2/h1-2,7-9,16,28H,3-6H2,(H,26,29);2*1H2 |
| InChIKey | QXDWDVCWLMFPCG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|