C21H21F5N2O3 — CID 144890664
4-fluoro-3-(3-fluoroazepan-1-yl)-N-(3,4,5-trifluorophenyl)benzamide;formaldehyde (PubChem CID 144890664) has the molecular formula C21H21F5N2O3 and a molecular weight of 444.40 g/mol. Its IUPAC name is 4-fluoro-3-(3-fluoroazepan-1-yl)-N-(3,4,5-trifluorophenyl)benzamide;formaldehyde.
| Compound Name | 4-fluoro-3-(3-fluoroazepan-1-yl)-N-(3,4,5-trifluorophenyl)benzamide;formaldehyde |
|---|---|
| PubChem CID | 144890664 |
| Molecular Formula | C21H21F5N2O3 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 4-fluoro-3-(3-fluoroazepan-1-yl)-N-(3,4,5-trifluorophenyl)benzamide;formaldehyde |
| SMILES | C=O.C=O.O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(F)c(N2CCCCC(F)C2)c1 |
| InChI | InChI=1S/C19H17F5N2O.2CH2O/c20-12-3-1-2-6-26(10-12)17-7-11(4-5-14(17)21)19(27)25-13-8-15(22)18(24)16(23)9-13;2*1-2/h4-5,7-9,12H,1-3,6,10H2,(H,25,27);2*1H2 |
| InChIKey | PRTWALJYZXKGQD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|