C22H24F4N2O4S — CID 122547327
4-(fluoromethyl)-3-(3-hydroxy-4-methylazocan-1-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 122547327) has the molecular formula C22H24F4N2O4S and a molecular weight of 488.50 g/mol. Its IUPAC name is 4-(fluoromethyl)-3-(3-hydroxy-4-methylazocan-1-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-(fluoromethyl)-3-(3-hydroxy-4-methylazocan-1-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 122547327 |
| Molecular Formula | C22H24F4N2O4S |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 4-(fluoromethyl)-3-(3-hydroxy-4-methylazocan-1-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC1CCCCN(S(=O)(=O)c2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2CF)CC1O |
| InChI | InChI=1S/C22H24F4N2O4S/c1-13-4-2-3-7-28(12-19(13)29)33(31,32)20-8-14(5-6-15(20)11-23)22(30)27-16-9-17(24)21(26)18(25)10-16/h5-6,8-10,13,19,29H,2-4,7,11-12H2,1H3,(H,27,30) |
| InChIKey | FLRSJMQTFDHXCU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|