C17H11F3N4OS2 — CID 153394604
3-(1,3-thiazol-4-yl)-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-carboxamide (PubChem CID 153394604) has the molecular formula C17H11F3N4OS2 and a molecular weight of 408.43 g/mol. Its IUPAC name is 3-(1,3-thiazol-4-yl)-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-carboxamide.
| Compound Name | 3-(1,3-thiazol-4-yl)-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 153394604 |
| Molecular Formula | C17H11F3N4OS2 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 3-(1,3-thiazol-4-yl)-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc2c(c1)SNC(c1cscn1)N2 |
| InChI | InChI=1S/C17H11F3N4OS2/c18-10-4-9(5-11(19)15(10)20)22-17(25)8-1-2-12-14(3-8)27-24-16(23-12)13-6-26-7-21-13/h1-7,16,23-24H,(H,22,25) |
| InChIKey | JZSKXXUUPBOLIE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|