C20H15F3N4OS — CID 153394631
3-methyl-3-pyridin-4-yl-N-(3,4,5-trifluorophenyl)-2,4-dihydro-1,2,4-benzothiadiazine-7-carboxamide (PubChem CID 153394631) has the molecular formula C20H15F3N4OS and a molecular weight of 416.43 g/mol. Its IUPAC name is 3-methyl-3-pyridin-4-yl-N-(3,4,5-trifluorophenyl)-2,4-dihydro-1,2,4-benzothiadiazine-7-carboxamide.
| Compound Name | 3-methyl-3-pyridin-4-yl-N-(3,4,5-trifluorophenyl)-2,4-dihydro-1,2,4-benzothiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 153394631 |
| Molecular Formula | C20H15F3N4OS |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 3-methyl-3-pyridin-4-yl-N-(3,4,5-trifluorophenyl)-2,4-dihydro-1,2,4-benzothiadiazine-7-carboxamide |
| SMILES | CC1(c2ccncc2)NSc2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2N1 |
| InChI | InChI=1S/C20H15F3N4OS/c1-20(12-4-6-24-7-5-12)26-16-3-2-11(8-17(16)29-27-20)19(28)25-13-9-14(21)18(23)15(22)10-13/h2-10,26-27H,1H3,(H,25,28) |
| InChIKey | IZZKLAYMZAUDAE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|