C19H11F3N4O4S — CID 146301326
1,1,3-trioxo-2-pyridin-3-yl-N-(3,4,5-trifluorophenyl)-4H-1λ6,2,4-benzothiadiazine-7-carboxamide (PubChem CID 146301326) has the molecular formula C19H11F3N4O4S and a molecular weight of 448.38 g/mol. Its IUPAC name is 1,1,3-trioxo-2-pyridin-3-yl-N-(3,4,5-trifluorophenyl)-4H-1λ6,2,4-benzothiadiazine-7-carboxamide.
| Compound Name | 1,1,3-trioxo-2-pyridin-3-yl-N-(3,4,5-trifluorophenyl)-4H-1λ6,2,4-benzothiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 146301326 |
| Molecular Formula | C19H11F3N4O4S |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 1,1,3-trioxo-2-pyridin-3-yl-N-(3,4,5-trifluorophenyl)-4H-1λ6,2,4-benzothiadiazine-7-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc2c(c1)S(=O)(=O)N(c1cccnc1)C(=O)N2 |
| InChI | InChI=1S/C19H11F3N4O4S/c20-13-7-11(8-14(21)17(13)22)24-18(27)10-3-4-15-16(6-10)31(29,30)26(19(28)25-15)12-2-1-5-23-9-12/h1-9H,(H,24,27)(H,25,28) |
| InChIKey | DTMXWQQHGQJORB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|