C19H17F3N4O4S — CID 146301476
2-(1-methylpyrrolidin-3-yl)-1,1,3-trioxo-N-(3,4,5-trifluorophenyl)-4H-1λ6,2,4-benzothiadiazine-7-carboxamide (PubChem CID 146301476) has the molecular formula C19H17F3N4O4S and a molecular weight of 454.43 g/mol. Its IUPAC name is 2-(1-methylpyrrolidin-3-yl)-1,1,3-trioxo-N-(3,4,5-trifluorophenyl)-4H-1λ6,2,4-benzothiadiazine-7-carboxamide.
| Compound Name | 2-(1-methylpyrrolidin-3-yl)-1,1,3-trioxo-N-(3,4,5-trifluorophenyl)-4H-1λ6,2,4-benzothiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 146301476 |
| Molecular Formula | C19H17F3N4O4S |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 2-(1-methylpyrrolidin-3-yl)-1,1,3-trioxo-N-(3,4,5-trifluorophenyl)-4H-1λ6,2,4-benzothiadiazine-7-carboxamide |
| SMILES | CN1CCC(N2C(=O)Nc3ccc(C(=O)Nc4cc(F)c(F)c(F)c4)cc3S2(=O)=O)C1 |
| InChI | InChI=1S/C19H17F3N4O4S/c1-25-5-4-12(9-25)26-19(28)24-15-3-2-10(6-16(15)31(26,29)30)18(27)23-11-7-13(20)17(22)14(21)8-11/h2-3,6-8,12H,4-5,9H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | WIZZBTIQZQUWOT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|