C19H14F3N5O3S — CID 146301306
3-methyl-1,1-dioxo-3-pyrazin-2-yl-N-(3,4,5-trifluorophenyl)-2,4-dihydro-1λ6,2,4-benzothiadiazine-7-carboxamide (PubChem CID 146301306) has the molecular formula C19H14F3N5O3S and a molecular weight of 449.41 g/mol. Its IUPAC name is 3-methyl-1,1-dioxo-3-pyrazin-2-yl-N-(3,4,5-trifluorophenyl)-2,4-dihydro-1λ6,2,4-benzothiadiazine-7-carboxamide.
| Compound Name | 3-methyl-1,1-dioxo-3-pyrazin-2-yl-N-(3,4,5-trifluorophenyl)-2,4-dihydro-1λ6,2,4-benzothiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 146301306 |
| Molecular Formula | C19H14F3N5O3S |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 3-methyl-1,1-dioxo-3-pyrazin-2-yl-N-(3,4,5-trifluorophenyl)-2,4-dihydro-1λ6,2,4-benzothiadiazine-7-carboxamide |
| SMILES | CC1(c2cnccn2)Nc2ccc(C(=O)Nc3cc(F)c(F)c(F)c3)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C19H14F3N5O3S/c1-19(16-9-23-4-5-24-16)26-14-3-2-10(6-15(14)31(29,30)27-19)18(28)25-11-7-12(20)17(22)13(21)8-11/h2-9,26-27H,1H3,(H,25,28) |
| InChIKey | WGIZYWCQZOQXSS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|