C21H13F3N4O4S — CID 146301296
1',1',2-trioxo-N-(3,4,5-trifluorophenyl)spiro[1H-indole-3,3'-2,4-dihydro-1λ6,2,4-benzothiadiazine]-7'-carboxamide (PubChem CID 146301296) has the molecular formula C21H13F3N4O4S and a molecular weight of 474.42 g/mol. Its IUPAC name is 1',1',2-trioxo-N-(3,4,5-trifluorophenyl)spiro[1H-indole-3,3'-2,4-dihydro-1λ6,2,4-benzothiadiazine]-7'-carboxamide.
| Compound Name | 1',1',2-trioxo-N-(3,4,5-trifluorophenyl)spiro[1H-indole-3,3'-2,4-dihydro-1λ6,2,4-benzothiadiazine]-7'-carboxamide |
|---|---|
| PubChem CID | 146301296 |
| Molecular Formula | C21H13F3N4O4S |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 1',1',2-trioxo-N-(3,4,5-trifluorophenyl)spiro[1H-indole-3,3'-2,4-dihydro-1λ6,2,4-benzothiadiazine]-7'-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc2c(c1)S(=O)(=O)NC1(N2)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C21H13F3N4O4S/c22-13-8-11(9-14(23)18(13)24)25-19(29)10-5-6-16-17(7-10)33(31,32)28-21(27-16)12-3-1-2-4-15(12)26-20(21)30/h1-9,27-28H,(H,25,29)(H,26,30) |
| InChIKey | ZPUDJYDUEPJORI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|