C18H16F3N3O4S — CID 146301494
11,11-dioxo-N-(3,4,5-trifluorophenyl)-1,2,3,4,4a,5-hexahydropyrazino[1,2-b][5,1,2]benzoxathiazepine-9-carboxamide (PubChem CID 146301494) has the molecular formula C18H16F3N3O4S and a molecular weight of 427.40 g/mol. Its IUPAC name is 11,11-dioxo-N-(3,4,5-trifluorophenyl)-1,2,3,4,4a,5-hexahydropyrazino[1,2-b][5,1,2]benzoxathiazepine-9-carboxamide.
| Compound Name | 11,11-dioxo-N-(3,4,5-trifluorophenyl)-1,2,3,4,4a,5-hexahydropyrazino[1,2-b][5,1,2]benzoxathiazepine-9-carboxamide |
|---|---|
| PubChem CID | 146301494 |
| Molecular Formula | C18H16F3N3O4S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 11,11-dioxo-N-(3,4,5-trifluorophenyl)-1,2,3,4,4a,5-hexahydropyrazino[1,2-b][5,1,2]benzoxathiazepine-9-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc2c(c1)S(=O)(=O)N1CCNCC1CO2 |
| InChI | InChI=1S/C18H16F3N3O4S/c19-13-6-11(7-14(20)17(13)21)23-18(25)10-1-2-15-16(5-10)29(26,27)24-4-3-22-8-12(24)9-28-15/h1-2,5-7,12,22H,3-4,8-9H2,(H,23,25) |
| InChIKey | ACOONSDCTWWLQL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|