C19H17F3N4O5S — CID 146301381
2-(4-hydroxycyclohexyl)-1,1,3-trioxo-N-(3,4,5-trifluorophenyl)-4H-pyrido[2,3-e][1,2,4]thiadiazine-7-carboxamide (PubChem CID 146301381) has the molecular formula C19H17F3N4O5S and a molecular weight of 470.43 g/mol. Its IUPAC name is 2-(4-hydroxycyclohexyl)-1,1,3-trioxo-N-(3,4,5-trifluorophenyl)-4H-pyrido[2,3-e][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | 2-(4-hydroxycyclohexyl)-1,1,3-trioxo-N-(3,4,5-trifluorophenyl)-4H-pyrido[2,3-e][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 146301381 |
| Molecular Formula | C19H17F3N4O5S |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 2-(4-hydroxycyclohexyl)-1,1,3-trioxo-N-(3,4,5-trifluorophenyl)-4H-pyrido[2,3-e][1,2,4]thiadiazine-7-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1cnc2c(c1)S(=O)(=O)N(C1CCC(O)CC1)C(=O)N2 |
| InChI | InChI=1S/C19H17F3N4O5S/c20-13-6-10(7-14(21)16(13)22)24-18(28)9-5-15-17(23-8-9)25-19(29)26(32(15,30)31)11-1-3-12(27)4-2-11/h5-8,11-12,27H,1-4H2,(H,24,28)(H,23,25,29) |
| InChIKey | HNNVCXYZTMDHDF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|