C18H19F3N4O4S — CID 146301674
6-amino-5-[(4-hydroxycyclohexyl)sulfamoyl]-N-(3,4,5-trifluorophenyl)pyridine-3-carboxamide (PubChem CID 146301674) has the molecular formula C18H19F3N4O4S and a molecular weight of 444.44 g/mol. Its IUPAC name is 6-amino-5-[(4-hydroxycyclohexyl)sulfamoyl]-N-(3,4,5-trifluorophenyl)pyridine-3-carboxamide.
| Compound Name | 6-amino-5-[(4-hydroxycyclohexyl)sulfamoyl]-N-(3,4,5-trifluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146301674 |
| Molecular Formula | C18H19F3N4O4S |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 6-amino-5-[(4-hydroxycyclohexyl)sulfamoyl]-N-(3,4,5-trifluorophenyl)pyridine-3-carboxamide |
| SMILES | Nc1ncc(C(=O)Nc2cc(F)c(F)c(F)c2)cc1S(=O)(=O)NC1CCC(O)CC1 |
| InChI | InChI=1S/C18H19F3N4O4S/c19-13-6-11(7-14(20)16(13)21)24-18(27)9-5-15(17(22)23-8-9)30(28,29)25-10-1-3-12(26)4-2-10/h5-8,10,12,25-26H,1-4H2,(H2,22,23)(H,24,27) |
| InChIKey | AHASNGATMZRVDK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|