C12H13F2NO4S — CID 104654330
3-(cyclopentylsulfamoyl)-4,5-difluorobenzoic acid (PubChem CID 104654330) has the molecular formula C12H13F2NO4S and a molecular weight of 305.30 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-4,5-difluorobenzoic acid.
| Compound Name | 3-(cyclopentylsulfamoyl)-4,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 104654330 |
| Molecular Formula | C12H13F2NO4S |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-4,5-difluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)c(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C12H13F2NO4S/c13-9-5-7(12(16)17)6-10(11(9)14)20(18,19)15-8-3-1-2-4-8/h5-6,8,15H,1-4H2,(H,16,17) |
| InChIKey | KGVABMBSAXRBJC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |