C13H15F2NO4S — CID 105113952
3,4-difluoro-5-[(1-methylcyclopentyl)sulfamoyl]benzoic acid (PubChem CID 105113952) has the molecular formula C13H15F2NO4S and a molecular weight of 319.33 g/mol. Its IUPAC name is 3,4-difluoro-5-[(1-methylcyclopentyl)sulfamoyl]benzoic acid.
| Compound Name | 3,4-difluoro-5-[(1-methylcyclopentyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 105113952 |
| Molecular Formula | C13H15F2NO4S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3,4-difluoro-5-[(1-methylcyclopentyl)sulfamoyl]benzoic acid |
| SMILES | CC1(NS(=O)(=O)c2cc(C(=O)O)cc(F)c2F)CCCC1 |
| InChI | InChI=1S/C13H15F2NO4S/c1-13(4-2-3-5-13)16-21(19,20)10-7-8(12(17)18)6-9(14)11(10)15/h6-7,16H,2-5H2,1H3,(H,17,18) |
| InChIKey | DXQPMZIKASOQHK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |