C20H12F5N3O2S — CID 146304039
3-(2,6-difluorophenyl)-1-oxo-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1λ4,2,4-benzothiadiazine-7-carboxamide (PubChem CID 146304039) has the molecular formula C20H12F5N3O2S and a molecular weight of 453.39 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-1-oxo-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1λ4,2,4-benzothiadiazine-7-carboxamide.
| Compound Name | 3-(2,6-difluorophenyl)-1-oxo-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1λ4,2,4-benzothiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 146304039 |
| Molecular Formula | C20H12F5N3O2S |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 3-(2,6-difluorophenyl)-1-oxo-N-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1λ4,2,4-benzothiadiazine-7-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc2c(c1)S(=O)NC(c1c(F)cccc1F)N2 |
| InChI | InChI=1S/C20H12F5N3O2S/c21-11-2-1-3-12(22)17(11)19-27-15-5-4-9(6-16(15)31(30)28-19)20(29)26-10-7-13(23)18(25)14(24)8-10/h1-8,19,27-28H,(H,26,29) |
| InChIKey | FWRWMTDRGLNQDZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|