C13H7F3NO3S- — CID 123569358
3-[(3,4,5-trifluorophenyl)carbamoyl]benzenesulfinate (PubChem CID 123569358) has the molecular formula C13H7F3NO3S- and a molecular weight of 314.26 g/mol. Its IUPAC name is 3-[(3,4,5-trifluorophenyl)carbamoyl]benzenesulfinate.
| Compound Name | 3-[(3,4,5-trifluorophenyl)carbamoyl]benzenesulfinate |
|---|---|
| PubChem CID | 123569358 |
| Molecular Formula | C13H7F3NO3S- |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 3-[(3,4,5-trifluorophenyl)carbamoyl]benzenesulfinate |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1cccc(S(=O)[O-])c1 |
| InChI | InChI=1S/C13H8F3NO3S/c14-10-5-8(6-11(15)12(10)16)17-13(18)7-2-1-3-9(4-7)21(19)20/h1-6H,(H,17,18)(H,19,20)/p-1 |
| InChIKey | NWOGNTASTXZHFD-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|