C16H14F3N3O3S — CID 146304042
2-(2-hydroxyethyl)-1-oxo-N-(3,4,5-trifluorophenyl)-3,4-dihydro-1λ4,2,4-benzothiadiazine-7-carboxamide (PubChem CID 146304042) has the molecular formula C16H14F3N3O3S and a molecular weight of 385.37 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-1-oxo-N-(3,4,5-trifluorophenyl)-3,4-dihydro-1λ4,2,4-benzothiadiazine-7-carboxamide.
| Compound Name | 2-(2-hydroxyethyl)-1-oxo-N-(3,4,5-trifluorophenyl)-3,4-dihydro-1λ4,2,4-benzothiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 146304042 |
| Molecular Formula | C16H14F3N3O3S |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-(2-hydroxyethyl)-1-oxo-N-(3,4,5-trifluorophenyl)-3,4-dihydro-1λ4,2,4-benzothiadiazine-7-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc2c(c1)S(=O)N(CCO)CN2 |
| InChI | InChI=1S/C16H14F3N3O3S/c17-11-6-10(7-12(18)15(11)19)21-16(24)9-1-2-13-14(5-9)26(25)22(3-4-23)8-20-13/h1-2,5-7,20,23H,3-4,8H2,(H,21,24) |
| InChIKey | DJPGWZFHTGEOHI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|