C15H14F3N3O4S — CID 146301245
4-amino-3-(2-hydroxyethylsulfamoyl)-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 146301245) has the molecular formula C15H14F3N3O4S and a molecular weight of 389.36 g/mol. Its IUPAC name is 4-amino-3-(2-hydroxyethylsulfamoyl)-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-amino-3-(2-hydroxyethylsulfamoyl)-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 146301245 |
| Molecular Formula | C15H14F3N3O4S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 4-amino-3-(2-hydroxyethylsulfamoyl)-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | Nc1ccc(C(=O)Nc2cc(F)c(F)c(F)c2)cc1S(=O)(=O)NCCO |
| InChI | InChI=1S/C15H14F3N3O4S/c16-10-6-9(7-11(17)14(10)18)21-15(23)8-1-2-12(19)13(5-8)26(24,25)20-3-4-22/h1-2,5-7,20,22H,3-4,19H2,(H,21,23) |
| InChIKey | AGSCUAYQPVAQFF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|