C17H15ClF3NO4S — CID 130397394
4-chloro-3-(1-hydroxy-2-methylpropan-2-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130397394) has the molecular formula C17H15ClF3NO4S and a molecular weight of 421.82 g/mol. Its IUPAC name is 4-chloro-3-(1-hydroxy-2-methylpropan-2-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-(1-hydroxy-2-methylpropan-2-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130397394 |
| Molecular Formula | C17H15ClF3NO4S |
| Molecular Weight | 421.82 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 4-chloro-3-(1-hydroxy-2-methylpropan-2-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC(C)(CO)S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C17H15ClF3NO4S/c1-17(2,8-23)27(25,26)14-5-9(3-4-11(14)18)16(24)22-10-6-12(19)15(21)13(20)7-10/h3-7,23H,8H2,1-2H3,(H,22,24) |
| InChIKey | DVFLVKVUQRUDKG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.82 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|