C22H23ClF3NO4S — CID 166671916
4-chloro-3-[[4-(hydroxymethyl)-1-methylcyclohexyl]methylsulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 166671916) has the molecular formula C22H23ClF3NO4S and a molecular weight of 489.94 g/mol. Its IUPAC name is 4-chloro-3-[[4-(hydroxymethyl)-1-methylcyclohexyl]methylsulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[4-(hydroxymethyl)-1-methylcyclohexyl]methylsulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 166671916 |
| Molecular Formula | C22H23ClF3NO4S |
| Molecular Weight | 489.94 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 4-chloro-3-[[4-(hydroxymethyl)-1-methylcyclohexyl]methylsulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC1(CS(=O)(=O)c2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2Cl)CCC(CO)CC1 |
| InChI | InChI=1S/C22H23ClF3NO4S/c1-22(6-4-13(11-28)5-7-22)12-32(30,31)19-8-14(2-3-16(19)23)21(29)27-15-9-17(24)20(26)18(25)10-15/h2-3,8-10,13,28H,4-7,11-12H2,1H3,(H,27,29) |
| InChIKey | JQJIZXJCLCNCGJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.94 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|