C22H21ClF3NO4S — CID 130425194
4-chloro-3-[[(5R)-3-hydroxy-7-methyl-6-bicyclo[3.1.1]heptanyl]methylsulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130425194) has the molecular formula C22H21ClF3NO4S and a molecular weight of 487.93 g/mol. Its IUPAC name is 4-chloro-3-[[(5R)-3-hydroxy-7-methyl-6-bicyclo[3.1.1]heptanyl]methylsulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(5R)-3-hydroxy-7-methyl-6-bicyclo[3.1.1]heptanyl]methylsulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130425194 |
| Molecular Formula | C22H21ClF3NO4S |
| Molecular Weight | 487.93 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 4-chloro-3-[[(5R)-3-hydroxy-7-methyl-6-bicyclo[3.1.1]heptanyl]methylsulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC1C2CC(O)C[C@H]1C2CS(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C22H21ClF3NO4S/c1-10-14-7-13(28)8-15(10)16(14)9-32(30,31)20-4-11(2-3-17(20)23)22(29)27-12-5-18(24)21(26)19(25)6-12/h2-6,10,13-16,28H,7-9H2,1H3,(H,27,29)/t10?,13?,14-,15?,16?/m1/s1 |
| InChIKey | LJDBPHRAOGHOCS-RSOLSLJKSA-N |
| XLogP | 4.44 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.93 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|