C21H24F4N2O5S — CID 146301460
3-(4,4-diethoxybutylsulfamoyl)-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 146301460) has the molecular formula C21H24F4N2O5S and a molecular weight of 492.49 g/mol. Its IUPAC name is 3-(4,4-diethoxybutylsulfamoyl)-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 3-(4,4-diethoxybutylsulfamoyl)-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 146301460 |
| Molecular Formula | C21H24F4N2O5S |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 3-(4,4-diethoxybutylsulfamoyl)-4-fluoro-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CCOC(CCCNS(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1F)OCC |
| InChI | InChI=1S/C21H24F4N2O5S/c1-3-31-19(32-4-2)6-5-9-26-33(29,30)18-10-13(7-8-15(18)22)21(28)27-14-11-16(23)20(25)17(24)12-14/h7-8,10-12,19,26H,3-6,9H2,1-2H3,(H,27,28) |
| InChIKey | OJHSNGDNHWPBBR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|