C15H12BrF3N2O — CID 169024633
N-(3-bromo-4,5-difluorophenyl)-2-(2-fluoropropan-2-yl)pyridine-4-carboxamide (PubChem CID 169024633) has the molecular formula C15H12BrF3N2O and a molecular weight of 373.17 g/mol. Its IUPAC name is N-(3-bromo-4,5-difluorophenyl)-2-(2-fluoropropan-2-yl)pyridine-4-carboxamide.
| Compound Name | N-(3-bromo-4,5-difluorophenyl)-2-(2-fluoropropan-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 169024633 |
| Molecular Formula | C15H12BrF3N2O |
| Molecular Weight | 373.17 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | N-(3-bromo-4,5-difluorophenyl)-2-(2-fluoropropan-2-yl)pyridine-4-carboxamide |
| SMILES | CC(C)(F)c1cc(C(=O)Nc2cc(F)c(F)c(Br)c2)ccn1 |
| InChI | InChI=1S/C15H12BrF3N2O/c1-15(2,19)12-5-8(3-4-20-12)14(22)21-9-6-10(16)13(18)11(17)7-9/h3-7H,1-2H3,(H,21,22) |
| InChIKey | JFXIMUPUJIPFBC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.17 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|