C21H19ClF3N3O — CID 168930044
N-[5-(2-chloro-4-pyridinyl)-2-fluorophenyl]-2-(2-fluoropropan-2-yl)pyridine-4-carboxamide;fluoromethane (PubChem CID 168930044) has the molecular formula C21H19ClF3N3O and a molecular weight of 421.85 g/mol. Its IUPAC name is N-[5-(2-chloro-4-pyridinyl)-2-fluorophenyl]-2-(2-fluoropropan-2-yl)pyridine-4-carboxamide;fluoromethane.
| Compound Name | N-[5-(2-chloro-4-pyridinyl)-2-fluorophenyl]-2-(2-fluoropropan-2-yl)pyridine-4-carboxamide;fluoromethane |
|---|---|
| PubChem CID | 168930044 |
| Molecular Formula | C21H19ClF3N3O |
| Molecular Weight | 421.85 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-[5-(2-chloro-4-pyridinyl)-2-fluorophenyl]-2-(2-fluoropropan-2-yl)pyridine-4-carboxamide;fluoromethane |
| SMILES | CC(C)(F)c1cc(C(=O)Nc2cc(-c3ccnc(Cl)c3)ccc2F)ccn1.CF |
| InChI | InChI=1S/C20H16ClF2N3O.CH3F/c1-20(2,23)17-10-14(6-7-24-17)19(27)26-16-9-12(3-4-15(16)22)13-5-8-25-18(21)11-13;1-2/h3-11H,1-2H3,(H,26,27);1H3 |
| InChIKey | VESKQEFNROMUAD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.85 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|