C12H6BrClF2N2O — CID 65469908
N-(4-bromo-2,6-difluorophenyl)-2-chloropyridine-4-carboxamide (PubChem CID 65469908) has the molecular formula C12H6BrClF2N2O and a molecular weight of 347.55 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)-2-chloropyridine-4-carboxamide.
| Compound Name | N-(4-bromo-2,6-difluorophenyl)-2-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 65469908 |
| Molecular Formula | C12H6BrClF2N2O |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)-2-chloropyridine-4-carboxamide |
| SMILES | O=C(Nc1c(F)cc(Br)cc1F)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C12H6BrClF2N2O/c13-7-4-8(15)11(9(16)5-7)18-12(19)6-1-2-17-10(14)3-6/h1-5H,(H,18,19) |
| InChIKey | WSDBRJBAIZUGIN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|