C11H5BrClF2NO2 — CID 65498748
N-(4-bromo-2,6-difluorophenyl)-5-chlorofuran-2-carboxamide (PubChem CID 65498748) has the molecular formula C11H5BrClF2NO2 and a molecular weight of 336.52 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)-5-chlorofuran-2-carboxamide.
| Compound Name | N-(4-bromo-2,6-difluorophenyl)-5-chlorofuran-2-carboxamide |
|---|---|
| PubChem CID | 65498748 |
| Molecular Formula | C11H5BrClF2NO2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 334.92 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)-5-chlorofuran-2-carboxamide |
| SMILES | O=C(Nc1c(F)cc(Br)cc1F)c1ccc(Cl)o1 |
| InChI | InChI=1S/C11H5BrClF2NO2/c12-5-3-6(14)10(7(15)4-5)16-11(17)8-1-2-9(13)18-8/h1-4H,(H,16,17) |
| InChIKey | WSTUGEGJBUCEEU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |