C11H5Cl2F2NO2 — CID 113343811
5-chloro-N-(2-chloro-4,6-difluorophenyl)furan-2-carboxamide (PubChem CID 113343811) has the molecular formula C11H5Cl2F2NO2 and a molecular weight of 292.07 g/mol. Its IUPAC name is 5-chloro-N-(2-chloro-4,6-difluorophenyl)furan-2-carboxamide.
| Compound Name | 5-chloro-N-(2-chloro-4,6-difluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 113343811 |
| Molecular Formula | C11H5Cl2F2NO2 |
| Molecular Weight | 292.07 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | 5-chloro-N-(2-chloro-4,6-difluorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1c(F)cc(F)cc1Cl)c1ccc(Cl)o1 |
| InChI | InChI=1S/C11H5Cl2F2NO2/c12-6-3-5(14)4-7(15)10(6)16-11(17)8-1-2-9(13)18-8/h1-4H,(H,16,17) |
| InChIKey | RAFZNLPHDKESRB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.07 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |