C12H8ClF2NO3 — CID 87031550
5-chloro-N-(3,5-difluoro-4-methoxyphenyl)furan-2-carboxamide (PubChem CID 87031550) has the molecular formula C12H8ClF2NO3 and a molecular weight of 287.65 g/mol. Its IUPAC name is 5-chloro-N-(3,5-difluoro-4-methoxyphenyl)furan-2-carboxamide.
| Compound Name | 5-chloro-N-(3,5-difluoro-4-methoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 87031550 |
| Molecular Formula | C12H8ClF2NO3 |
| Molecular Weight | 287.65 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 5-chloro-N-(3,5-difluoro-4-methoxyphenyl)furan-2-carboxamide |
| SMILES | COc1c(F)cc(NC(=O)c2ccc(Cl)o2)cc1F |
| InChI | InChI=1S/C12H8ClF2NO3/c1-18-11-7(14)4-6(5-8(11)15)16-12(17)9-2-3-10(13)19-9/h2-5H,1H3,(H,16,17) |
| InChIKey | AEEYNAVNJYFXEA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.65 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |