C15H13BrF2N2O — CID 65468967
4-(2-aminoethyl)-N-(4-bromo-2,6-difluorophenyl)benzamide (PubChem CID 65468967) has the molecular formula C15H13BrF2N2O and a molecular weight of 355.18 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-(4-bromo-2,6-difluorophenyl)benzamide.
| Compound Name | 4-(2-aminoethyl)-N-(4-bromo-2,6-difluorophenyl)benzamide |
|---|---|
| PubChem CID | 65468967 |
| Molecular Formula | C15H13BrF2N2O |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 4-(2-aminoethyl)-N-(4-bromo-2,6-difluorophenyl)benzamide |
| SMILES | NCCc1ccc(C(=O)Nc2c(F)cc(Br)cc2F)cc1 |
| InChI | InChI=1S/C15H13BrF2N2O/c16-11-7-12(17)14(13(18)8-11)20-15(21)10-3-1-9(2-4-10)5-6-19/h1-4,7-8H,5-6,19H2,(H,20,21) |
| InChIKey | RMKUUUWFPVFEOE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |