C14H9Br2F2NO — CID 102850915
N-(2-bromo-4,6-difluorophenyl)-4-(bromomethyl)benzamide (PubChem CID 102850915) has the molecular formula C14H9Br2F2NO and a molecular weight of 405.04 g/mol. Its IUPAC name is N-(2-bromo-4,6-difluorophenyl)-4-(bromomethyl)benzamide.
| Compound Name | N-(2-bromo-4,6-difluorophenyl)-4-(bromomethyl)benzamide |
|---|---|
| PubChem CID | 102850915 |
| Molecular Formula | C14H9Br2F2NO |
| Molecular Weight | 405.04 g/mol |
| Exact Mass | 402.90 |
| IUPAC Name | N-(2-bromo-4,6-difluorophenyl)-4-(bromomethyl)benzamide |
| SMILES | O=C(Nc1c(F)cc(F)cc1Br)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C14H9Br2F2NO/c15-7-8-1-3-9(4-2-8)14(20)19-13-11(16)5-10(17)6-12(13)18/h1-6H,7H2,(H,19,20) |
| InChIKey | HSNKNQHHKBDCSP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.04 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|