C13H8BrF2NO2 — CID 43132174
N-(2-bromo-4,6-difluorophenyl)-3-hydroxybenzamide (PubChem CID 43132174) has the molecular formula C13H8BrF2NO2 and a molecular weight of 328.11 g/mol. Its IUPAC name is N-(2-bromo-4,6-difluorophenyl)-3-hydroxybenzamide.
| Compound Name | N-(2-bromo-4,6-difluorophenyl)-3-hydroxybenzamide |
|---|---|
| PubChem CID | 43132174 |
| Molecular Formula | C13H8BrF2NO2 |
| Molecular Weight | 328.11 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | N-(2-bromo-4,6-difluorophenyl)-3-hydroxybenzamide |
| SMILES | O=C(Nc1c(F)cc(F)cc1Br)c1cccc(O)c1 |
| InChI | InChI=1S/C13H8BrF2NO2/c14-10-5-8(15)6-11(16)12(10)17-13(19)7-2-1-3-9(18)4-7/h1-6,18H,(H,17,19) |
| InChIKey | ZZFCCVLEXFXFDR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.11 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |