C14H10BrF3N2O — CID 60862529
3-amino-N-(2-bromo-4,6-difluorophenyl)-5-fluoro-4-methylbenzamide (PubChem CID 60862529) has the molecular formula C14H10BrF3N2O and a molecular weight of 359.15 g/mol. Its IUPAC name is 3-amino-N-(2-bromo-4,6-difluorophenyl)-5-fluoro-4-methylbenzamide.
| Compound Name | 3-amino-N-(2-bromo-4,6-difluorophenyl)-5-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 60862529 |
| Molecular Formula | C14H10BrF3N2O |
| Molecular Weight | 359.15 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | 3-amino-N-(2-bromo-4,6-difluorophenyl)-5-fluoro-4-methylbenzamide |
| SMILES | Cc1c(N)cc(C(=O)Nc2c(F)cc(F)cc2Br)cc1F |
| InChI | InChI=1S/C14H10BrF3N2O/c1-6-10(17)2-7(3-12(6)19)14(21)20-13-9(15)4-8(16)5-11(13)18/h2-5H,19H2,1H3,(H,20,21) |
| InChIKey | YDQYESQWZWSQFV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.15 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|