C14H9Br2Cl2NO — CID 102850859
N-(4-bromo-2,6-dichlorophenyl)-4-(bromomethyl)benzamide (PubChem CID 102850859) has the molecular formula C14H9Br2Cl2NO and a molecular weight of 437.95 g/mol. Its IUPAC name is N-(4-bromo-2,6-dichlorophenyl)-4-(bromomethyl)benzamide.
| Compound Name | N-(4-bromo-2,6-dichlorophenyl)-4-(bromomethyl)benzamide |
|---|---|
| PubChem CID | 102850859 |
| Molecular Formula | C14H9Br2Cl2NO |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 434.84 |
| IUPAC Name | N-(4-bromo-2,6-dichlorophenyl)-4-(bromomethyl)benzamide |
| SMILES | O=C(Nc1c(Cl)cc(Br)cc1Cl)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C14H9Br2Cl2NO/c15-7-8-1-3-9(4-2-8)14(20)19-13-11(17)5-10(16)6-12(13)18/h1-6H,7H2,(H,19,20) |
| InChIKey | RGPMWLOLGOMTAR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|