About N-(4-bromo-2,6-difluorophenyl)-2-chloropyridin-4-amine
N-(4-bromo-2,6-difluorophenyl)-2-chloropyridin-4-amine (PubChem CID 102824263) has the molecular formula C11H6BrClF2N2
and a molecular weight of 319.54 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)-2-chloropyridin-4-amine.
Molecular Properties
| Compound Name | N-(4-bromo-2,6-difluorophenyl)-2-chloropyridin-4-amine |
| PubChem CID | 102824263 |
| Molecular Formula | C11H6BrClF2N2 |
| Molecular Weight | 319.54 g/mol |
| Exact Mass | 317.94 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)-2-chloropyridin-4-amine |
| SMILES | Fc1cc(Br)cc(F)c1Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C11H6BrClF2N2/c12-6-3-8(14)11(9(15)4-6)17-7-1-2-16-10(13)5-7/h1-5H,(H,16,17) |
| InChIKey | XZAYZBRULAQKGH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-2,6-difluorophenyl)-2-chloropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-2,6-difluorophenyl)-2-chloropyridin-4-amine?
The IUPAC name of N-(4-bromo-2,6-difluorophenyl)-2-chloropyridin-4-amine (CID 102824263) is N-(4-bromo-2,6-difluorophenyl)-2-chloropyridin-4-amine.
What is the SMILES notation for N-(4-bromo-2,6-difluorophenyl)-2-chloropyridin-4-amine?
The canonical SMILES for N-(4-bromo-2,6-difluorophenyl)-2-chloropyridin-4-amine is Fc1cc(Br)cc(F)c1Nc1ccnc(Cl)c1.
What is the InChIKey of N-(4-bromo-2,6-difluorophenyl)-2-chloropyridin-4-amine?
The InChIKey is XZAYZBRULAQKGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6BrClF2N2/c12-6-3-8(14)11(9(15)4-6)17-7-1-2-16-10(13)5-7/h1-5H,(H,16,17).
What are the key properties of N-(4-bromo-2,6-difluorophenyl)-2-chloropyridin-4-amine?
N-(4-bromo-2,6-difluorophenyl)-2-chloropyridin-4-amine has a molecular weight of 319.54 g/mol, XLogP of 4.52, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-2,6-difluorophenyl)-2-chloropyridin-4-amine is sourced from PubChem (CID 102824263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).