C11H5BrClF2NO — CID 107098123
4-(5-bromo-2,3-difluorophenoxy)-2-chloropyridine (PubChem CID 107098123) has the molecular formula C11H5BrClF2NO and a molecular weight of 320.52 g/mol. Its IUPAC name is 4-(5-bromo-2,3-difluorophenoxy)-2-chloropyridine.
| Compound Name | 4-(5-bromo-2,3-difluorophenoxy)-2-chloropyridine |
|---|---|
| PubChem CID | 107098123 |
| Molecular Formula | C11H5BrClF2NO |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 318.92 |
| IUPAC Name | 4-(5-bromo-2,3-difluorophenoxy)-2-chloropyridine |
| SMILES | Fc1cc(Br)cc(Oc2ccnc(Cl)c2)c1F |
| InChI | InChI=1S/C11H5BrClF2NO/c12-6-3-8(14)11(15)9(4-6)17-7-1-2-16-10(13)5-7/h1-5H |
| InChIKey | BCCNIMSQPUOUJH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|