C13H11BrF2N2O — CID 107102586
4-(5-bromo-2,3-difluorophenoxy)-N-ethylpyridin-2-amine (PubChem CID 107102586) has the molecular formula C13H11BrF2N2O and a molecular weight of 329.14 g/mol. Its IUPAC name is 4-(5-bromo-2,3-difluorophenoxy)-N-ethylpyridin-2-amine.
| Compound Name | 4-(5-bromo-2,3-difluorophenoxy)-N-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 107102586 |
| Molecular Formula | C13H11BrF2N2O |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 4-(5-bromo-2,3-difluorophenoxy)-N-ethylpyridin-2-amine |
| SMILES | CCNc1cc(Oc2cc(Br)cc(F)c2F)ccn1 |
| InChI | InChI=1S/C13H11BrF2N2O/c1-2-17-12-7-9(3-4-18-12)19-11-6-8(14)5-10(15)13(11)16/h3-7H,2H2,1H3,(H,17,18) |
| InChIKey | PXNJHVBEYPKWJL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|