C11H8F3N3 — CID 113367916
4-N-(2,4,6-trifluorophenyl)pyridine-2,4-diamine (PubChem CID 113367916) has the molecular formula C11H8F3N3 and a molecular weight of 239.20 g/mol. Its IUPAC name is 4-N-(2,4,6-trifluorophenyl)pyridine-2,4-diamine.
| Compound Name | 4-N-(2,4,6-trifluorophenyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 113367916 |
| Molecular Formula | C11H8F3N3 |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 4-N-(2,4,6-trifluorophenyl)pyridine-2,4-diamine |
| SMILES | Nc1cc(Nc2c(F)cc(F)cc2F)ccn1 |
| InChI | InChI=1S/C11H8F3N3/c12-6-3-8(13)11(9(14)4-6)17-7-1-2-16-10(15)5-7/h1-5H,(H3,15,16,17) |
| InChIKey | LNSJCOOIUKWRHS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |