C11H9BrClFN4 — CID 107617932
N-(2-bromo-6-chloro-4-fluorophenyl)-2-hydrazinylpyridin-4-amine (PubChem CID 107617932) has the molecular formula C11H9BrClFN4 and a molecular weight of 331.58 g/mol. Its IUPAC name is N-(2-bromo-6-chloro-4-fluorophenyl)-2-hydrazinylpyridin-4-amine.
| Compound Name | N-(2-bromo-6-chloro-4-fluorophenyl)-2-hydrazinylpyridin-4-amine |
|---|---|
| PubChem CID | 107617932 |
| Molecular Formula | C11H9BrClFN4 |
| Molecular Weight | 331.58 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | N-(2-bromo-6-chloro-4-fluorophenyl)-2-hydrazinylpyridin-4-amine |
| SMILES | NNc1cc(Nc2c(Cl)cc(F)cc2Br)ccn1 |
| InChI | InChI=1S/C11H9BrClFN4/c12-8-3-6(14)4-9(13)11(8)17-7-1-2-16-10(5-7)18-15/h1-5H,15H2,(H2,16,17,18) |
| InChIKey | WLYGQKSYNGUKMP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|