C10H5Br2ClFN3 — CID 107614902
6-bromo-N-(2-bromo-6-chloro-4-fluorophenyl)pyrimidin-4-amine (PubChem CID 107614902) has the molecular formula C10H5Br2ClFN3 and a molecular weight of 381.43 g/mol. Its IUPAC name is 6-bromo-N-(2-bromo-6-chloro-4-fluorophenyl)pyrimidin-4-amine.
| Compound Name | 6-bromo-N-(2-bromo-6-chloro-4-fluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107614902 |
| Molecular Formula | C10H5Br2ClFN3 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 378.85 |
| IUPAC Name | 6-bromo-N-(2-bromo-6-chloro-4-fluorophenyl)pyrimidin-4-amine |
| SMILES | Fc1cc(Cl)c(Nc2cc(Br)ncn2)c(Br)c1 |
| InChI | InChI=1S/C10H5Br2ClFN3/c11-6-1-5(14)2-7(13)10(6)17-9-3-8(12)15-4-16-9/h1-4H,(H,15,16,17) |
| InChIKey | CWPHBBZHMOTUMM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |